About 7-chloro-2-ethyl-1,3-benzoxazole;ethane
7-chloro-2-ethyl-1,3-benzoxazole;ethane (PubChem CID 145422822) has the molecular formula C11H14ClNO
and a molecular weight of 211.69 g/mol. Its IUPAC name is 7-chloro-2-ethyl-1,3-benzoxazole;ethane.
Molecular Properties
| Compound Name | 7-chloro-2-ethyl-1,3-benzoxazole;ethane |
| PubChem CID | 145422822 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 7-chloro-2-ethyl-1,3-benzoxazole;ethane |
| SMILES | CC.CCc1nc2cccc(Cl)c2o1 |
| InChI | InChI=1S/C9H8ClNO.C2H6/c1-2-8-11-7-5-3-4-6(10)9(7)12-8;1-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | PDNPVHRVAXWRSB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-2-ethyl-1,3-benzoxazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-ethyl-1,3-benzoxazole;ethane?
The IUPAC name of 7-chloro-2-ethyl-1,3-benzoxazole;ethane (CID 145422822) is 7-chloro-2-ethyl-1,3-benzoxazole;ethane.
What is the SMILES notation for 7-chloro-2-ethyl-1,3-benzoxazole;ethane?
The canonical SMILES for 7-chloro-2-ethyl-1,3-benzoxazole;ethane is CC.CCc1nc2cccc(Cl)c2o1.
What is the InChIKey of 7-chloro-2-ethyl-1,3-benzoxazole;ethane?
The InChIKey is PDNPVHRVAXWRSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNO.C2H6/c1-2-8-11-7-5-3-4-6(10)9(7)12-8;1-2/h3-5H,2H2,1H3;1-2H3.
What are the key properties of 7-chloro-2-ethyl-1,3-benzoxazole;ethane?
7-chloro-2-ethyl-1,3-benzoxazole;ethane has a molecular weight of 211.69 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-ethyl-1,3-benzoxazole;ethane is sourced from PubChem (CID 145422822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).