C17H17ClF3N5O2 — CID 145422972
N-(1-aminoethylidene)-1-[3-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]piperidine-2-carboxamide (PubChem CID 145422972) has the molecular formula C17H17ClF3N5O2 and a molecular weight of 415.80 g/mol. Its IUPAC name is N-(1-aminoethylidene)-1-[3-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]piperidine-2-carboxamide.
| Compound Name | N-(1-aminoethylidene)-1-[3-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 145422972 |
| Molecular Formula | C17H17ClF3N5O2 |
| Molecular Weight | 415.80 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-(1-aminoethylidene)-1-[3-chloro-4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]piperidine-2-carboxamide |
| SMILES | C/C(N)=N\C(=O)C1CCCCN1c1ccc(-c2noc(C(F)(F)F)n2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClF3N5O2/c1-9(22)23-15(27)13-4-2-3-7-26(13)10-5-6-11(12(18)8-10)14-24-16(28-25-14)17(19,20)21/h5-6,8,13H,2-4,7H2,1H3,(H2,22,23,27) |
| InChIKey | HWTXHDVTSDYKLA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|