C18H32N2O5 — CID 145423271
[(2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-yl] acetate;methanamine;methyl N-(2-methoxyethyl)carbamate (PubChem CID 145423271) has the molecular formula C18H32N2O5 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-yl] acetate;methanamine;methyl N-(2-methoxyethyl)carbamate.
| Compound Name | [(2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-yl] acetate;methanamine;methyl N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 145423271 |
| Molecular Formula | C18H32N2O5 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | [(2Z,4E,6Z)-5-ethenylocta-2,4,6-trien-4-yl] acetate;methanamine;methyl N-(2-methoxyethyl)carbamate |
| SMILES | C=CC(/C=C\C)=C(/C=C\C)OC(C)=O.CN.COCCNC(=O)OC |
| InChI | InChI=1S/C12H16O2.C5H11NO3.CH5N/c1-5-8-11(7-3)12(9-6-2)14-10(4)13;1-8-4-3-6-5(7)9-2;1-2/h5-9H,3H2,1-2,4H3;3-4H2,1-2H3,(H,6,7);2H2,1H3/b8-5-,9-6-,12-11+;; |
| InChIKey | HAPOWNSXBKOHKH-PUBXZNELSA-N |
| XLogP | 2.71 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|