About (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene
(Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene (PubChem CID 145423500) has the molecular formula C16H33NS
and a molecular weight of 271.51 g/mol. Its IUPAC name is (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene.
Molecular Properties
| Compound Name | (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene |
| PubChem CID | 145423500 |
| Molecular Formula | C16H33NS |
| Molecular Weight | 271.51 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene |
| SMILES | C/C=C\C.C=C/C=C\C.CCN(CC)CCSC |
| InChI | InChI=1S/C7H17NS.C5H8.C4H8/c1-4-8(5-2)6-7-9-3;1-3-5-4-2;1-3-4-2/h4-7H2,1-3H3;3-5H,1H2,2H3;3-4H,1-2H3/b;5-4-;4-3- |
| InChIKey | IDYQJOOMWKTRQF-LVHBJSLOSA-N |
| XLogP | 5.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.51 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene?
The IUPAC name of (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene (CID 145423500) is (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene.
What is the SMILES notation for (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene?
The canonical SMILES for (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene is C/C=C\C.C=C/C=C\C.CCN(CC)CCSC.
What is the InChIKey of (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene?
The InChIKey is IDYQJOOMWKTRQF-LVHBJSLOSA-N. The full InChI is InChI=1S/C7H17NS.C5H8.C4H8/c1-4-8(5-2)6-7-9-3;1-3-5-4-2;1-3-4-2/h4-7H2,1-3H3;3-5H,1H2,2H3;3-4H,1-2H3/b;5-4-;4-3-.
What are the key properties of (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene?
(Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene has a molecular weight of 271.51 g/mol, XLogP of 5.02, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;N,N-diethyl-2-methylsulfanylethanamine;(3Z)-penta-1,3-diene is sourced from PubChem (CID 145423500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).