About 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid
3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid (PubChem CID 145423553) has the molecular formula C9H16FN2O3P
and a molecular weight of 250.21 g/mol. Its IUPAC name is 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid.
Molecular Properties
| Compound Name | 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid |
| PubChem CID | 145423553 |
| Molecular Formula | C9H16FN2O3P |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid |
| SMILES | C=C/C=C/NC(=C)NCCCP(=O)(O)OF |
| InChI | InChI=1S/C9H16FN2O3P/c1-3-4-6-11-9(2)12-7-5-8-16(13,14)15-10/h3-4,6,11-12H,1-2,5,7-8H2,(H,13,14)/b6-4+ |
| InChIKey | LAMWCZXQXLFIIS-GQCTYLIASA-N |
| XLogP | 1.81 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid?
The IUPAC name of 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid (CID 145423553) is 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid.
What is the SMILES notation for 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid?
The canonical SMILES for 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid is C=C/C=C/NC(=C)NCCCP(=O)(O)OF.
What is the InChIKey of 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid?
The InChIKey is LAMWCZXQXLFIIS-GQCTYLIASA-N. The full InChI is InChI=1S/C9H16FN2O3P/c1-3-4-6-11-9(2)12-7-5-8-16(13,14)15-10/h3-4,6,11-12H,1-2,5,7-8H2,(H,13,14)/b6-4+.
What are the key properties of 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid?
3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid has a molecular weight of 250.21 g/mol, XLogP of 1.81, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[[(1E)-buta-1,3-dienyl]amino]ethenylamino]propyl-fluorooxyphosphinic acid is sourced from PubChem (CID 145423553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).