About 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate
1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate (PubChem CID 145423953) has the molecular formula C14H32N2O3
and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate.
Molecular Properties
| Compound Name | 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate |
| PubChem CID | 145423953 |
| Molecular Formula | C14H32N2O3 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.24 |
| IUPAC Name | 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate |
| SMILES | CC(C)N(N)C(C)C.CC(C)OC(=O)C(C)CCO |
| InChI | InChI=1S/C8H16O3.C6H16N2/c1-6(2)11-8(10)7(3)4-5-9;1-5(2)8(7)6(3)4/h6-7,9H,4-5H2,1-3H3;5-6H,7H2,1-4H3 |
| InChIKey | ZEOYYJKMQAECRI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate?
The IUPAC name of 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate (CID 145423953) is 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate.
What is the SMILES notation for 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate?
The canonical SMILES for 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate is CC(C)N(N)C(C)C.CC(C)OC(=O)C(C)CCO.
What is the InChIKey of 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate?
The InChIKey is ZEOYYJKMQAECRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3.C6H16N2/c1-6(2)11-8(10)7(3)4-5-9;1-5(2)8(7)6(3)4/h6-7,9H,4-5H2,1-3H3;5-6H,7H2,1-4H3.
What are the key properties of 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate?
1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate has a molecular weight of 276.42 g/mol, XLogP of 1.94, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(propan-2-yl)hydrazine;propan-2-yl 4-hydroxy-2-methylbutanoate is sourced from PubChem (CID 145423953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).