C19H16ClFN4OS — CID 145424067
3-(3-chlorophenyl)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-6-(methylamino)pyrimidin-4-one (PubChem CID 145424067) has the molecular formula C19H16ClFN4OS and a molecular weight of 402.88 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-6-(methylamino)pyrimidin-4-one.
| Compound Name | 3-(3-chlorophenyl)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-6-(methylamino)pyrimidin-4-one |
|---|---|
| PubChem CID | 145424067 |
| Molecular Formula | C19H16ClFN4OS |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 3-(3-chlorophenyl)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-6-(methylamino)pyrimidin-4-one |
| SMILES | [H]/N=C/c1c(NC)nc(SCc2cccc(F)c2)n(-c2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C19H16ClFN4OS/c1-23-17-16(10-22)18(26)25(15-7-3-5-13(20)9-15)19(24-17)27-11-12-4-2-6-14(21)8-12/h2-10,22-23H,11H2,1H3/b22-10+ |
| InChIKey | PBAPPUDBJJHNIQ-LSHDLFTRSA-N |
| XLogP | 4.36 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|