C20H19FN4OS — CID 145424082
6-(ethylamino)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-3-phenylpyrimidin-4-one (PubChem CID 145424082) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 6-(ethylamino)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-3-phenylpyrimidin-4-one.
| Compound Name | 6-(ethylamino)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-3-phenylpyrimidin-4-one |
|---|---|
| PubChem CID | 145424082 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 6-(ethylamino)-2-[(3-fluorophenyl)methylsulfanyl]-5-methanimidoyl-3-phenylpyrimidin-4-one |
| SMILES | [H]/N=C/c1c(NCC)nc(SCc2cccc(F)c2)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H19FN4OS/c1-2-23-18-17(12-22)19(26)25(16-9-4-3-5-10-16)20(24-18)27-13-14-7-6-8-15(21)11-14/h3-12,22-23H,2,13H2,1H3/b22-12+ |
| InChIKey | PUHDPMJWCZCFEV-WSDLNYQXSA-N |
| XLogP | 4.09 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|