About 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane
1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane (PubChem CID 145424185) has the molecular formula C24H26Br4
and a molecular weight of 634.09 g/mol. Its IUPAC name is 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane.
Molecular Properties
| Compound Name | 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane |
| PubChem CID | 145424185 |
| Molecular Formula | C24H26Br4 |
| Molecular Weight | 634.09 g/mol |
| Exact Mass | 629.88 |
| IUPAC Name | 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane |
| SMILES | BrCc1ccc(CBr)cc1.BrCc1ccccc1-c1ccccc1CBr.CC |
| InChI | InChI=1S/C14H12Br2.C8H8Br2.C2H6/c15-9-11-5-1-3-7-13(11)14-8-4-2-6-12(14)10-16;9-5-7-1-2-8(6-10)4-3-7;1-2/h1-8H,9-10H2;1-4H,5-6H2;1-2H3 |
| InChIKey | SNAVWAJQZKRCGS-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.09 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane?
The IUPAC name of 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane (CID 145424185) is 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane.
What is the SMILES notation for 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane?
The canonical SMILES for 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane is BrCc1ccc(CBr)cc1.BrCc1ccccc1-c1ccccc1CBr.CC.
What is the InChIKey of 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane?
The InChIKey is SNAVWAJQZKRCGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12Br2.C8H8Br2.C2H6/c15-9-11-5-1-3-7-13(11)14-8-4-2-6-12(14)10-16;9-5-7-1-2-8(6-10)4-3-7;1-2/h1-8H,9-10H2;1-4H,5-6H2;1-2H3.
What are the key properties of 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane?
1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane has a molecular weight of 634.09 g/mol, XLogP of 9.65, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(bromomethyl)benzene;1-(bromomethyl)-2-[2-(bromomethyl)phenyl]benzene;ethane is sourced from PubChem (CID 145424185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).