C23H31N5 — CID 145424418
N-methyl-3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]propan-1-amine (PubChem CID 145424418) has the molecular formula C23H31N5 and a molecular weight of 377.54 g/mol. Its IUPAC name is N-methyl-3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]propan-1-amine.
| Compound Name | N-methyl-3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 145424418 |
| Molecular Formula | C23H31N5 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | N-methyl-3-[2-[(2R,6S)-1-methyl-6-(3-methyl-2-pyridinyl)piperidin-2-yl]benzimidazol-1-yl]propan-1-amine |
| SMILES | CNCCCn1c([C@H]2CCC[C@@H](c3ncccc3C)N2C)nc2ccccc21 |
| InChI | InChI=1S/C23H31N5/c1-17-9-7-15-25-22(17)20-12-6-13-21(27(20)3)23-26-18-10-4-5-11-19(18)28(23)16-8-14-24-2/h4-5,7,9-11,15,20-21,24H,6,8,12-14,16H2,1-3H3/t20-,21+/m0/s1 |
| InChIKey | FVVDYRJTLJVTEQ-LEWJYISDSA-N |
| XLogP | 4.25 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|