About ethane;1-ethenylpyridin-2-imine
ethane;1-ethenylpyridin-2-imine (PubChem CID 145424502) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;1-ethenylpyridin-2-imine.
Molecular Properties
| Compound Name | ethane;1-ethenylpyridin-2-imine |
| PubChem CID | 145424502 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;1-ethenylpyridin-2-imine |
| SMILES | CC.CC.[H]/N=c1\ccccn1C=C |
| InChI | InChI=1S/C7H8N2.2C2H6/c1-2-9-6-4-3-5-7(9)8;2*1-2/h2-6,8H,1H2;2*1-2H3/b8-7+;; |
| InChIKey | AFSXQTXFELLMPC-MIIBGCIDSA-N |
| XLogP | 3.12 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;1-ethenylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethenylpyridin-2-imine?
The IUPAC name of ethane;1-ethenylpyridin-2-imine (CID 145424502) is ethane;1-ethenylpyridin-2-imine.
What is the SMILES notation for ethane;1-ethenylpyridin-2-imine?
The canonical SMILES for ethane;1-ethenylpyridin-2-imine is CC.CC.[H]/N=c1\ccccn1C=C.
What is the InChIKey of ethane;1-ethenylpyridin-2-imine?
The InChIKey is AFSXQTXFELLMPC-MIIBGCIDSA-N. The full InChI is InChI=1S/C7H8N2.2C2H6/c1-2-9-6-4-3-5-7(9)8;2*1-2/h2-6,8H,1H2;2*1-2H3/b8-7+;;.
What are the key properties of ethane;1-ethenylpyridin-2-imine?
ethane;1-ethenylpyridin-2-imine has a molecular weight of 180.29 g/mol, XLogP of 3.12, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethenylpyridin-2-imine is sourced from PubChem (CID 145424502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).