C16H20N4O — CID 145424612
(E)-4-[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]but-3-en-2-one (PubChem CID 145424612) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is (E)-4-[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]but-3-en-2-one.
| Compound Name | (E)-4-[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 145424612 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (E)-4-[5-(4-methylpiperazin-1-yl)imidazo[1,2-a]pyridin-2-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cn2c(N3CCN(C)CC3)cccc2n1 |
| InChI | InChI=1S/C16H20N4O/c1-13(21)6-7-14-12-20-15(17-14)4-3-5-16(20)19-10-8-18(2)9-11-19/h3-7,12H,8-11H2,1-2H3/b7-6+ |
| InChIKey | IMCHNARUDRXERP-VOTSOKGWSA-N |
| XLogP | 1.69 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|