C9H13Br2N3 — CID 145425679
6,8-dibromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazine;ethane (PubChem CID 145425679) has the molecular formula C9H13Br2N3 and a molecular weight of 323.03 g/mol. Its IUPAC name is 6,8-dibromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazine;ethane.
| Compound Name | 6,8-dibromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazine;ethane |
|---|---|
| PubChem CID | 145425679 |
| Molecular Formula | C9H13Br2N3 |
| Molecular Weight | 323.03 g/mol |
| Exact Mass | 320.95 |
| IUPAC Name | 6,8-dibromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazine;ethane |
| SMILES | CC.CC1=CNC2C(Br)=NC(Br)=CN12 |
| InChI | InChI=1S/C7H7Br2N3.C2H6/c1-4-2-10-7-6(9)11-5(8)3-12(4)7;1-2/h2-3,7,10H,1H3;1-2H3 |
| InChIKey | NYYCMIYHCQRZJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.03 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|