About (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole
(6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole (PubChem CID 145426007) has the molecular formula C14H16N4O2S
and a molecular weight of 304.38 g/mol. Its IUPAC name is (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole |
| PubChem CID | 145426007 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole |
| SMILES | CCc1nc(C(C)C)cs1.N#Cc1ccc(OC=O)nn1 |
| InChI | InChI=1S/C8H13NS.C6H3N3O2/c1-4-8-9-7(5-10-8)6(2)3;7-3-5-1-2-6(9-8-5)11-4-10/h5-6H,4H2,1-3H3;1-2,4H |
| InChIKey | GAWMOGKPPRUELD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 88.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole?
The IUPAC name of (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole (CID 145426007) is (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole.
What is the SMILES notation for (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole?
The canonical SMILES for (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole is CCc1nc(C(C)C)cs1.N#Cc1ccc(OC=O)nn1.
What is the InChIKey of (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole?
The InChIKey is GAWMOGKPPRUELD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS.C6H3N3O2/c1-4-8-9-7(5-10-8)6(2)3;7-3-5-1-2-6(9-8-5)11-4-10/h5-6H,4H2,1-3H3;1-2,4H.
What are the key properties of (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole?
(6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole has a molecular weight of 304.38 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (6-cyanopyridazin-3-yl) formate;2-ethyl-4-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 145426007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).