C22H23N3S — CID 145426040
6-pyrimidin-5-yl-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline (PubChem CID 145426040) has the molecular formula C22H23N3S and a molecular weight of 361.51 g/mol. Its IUPAC name is 6-pyrimidin-5-yl-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-pyrimidin-5-yl-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 145426040 |
| Molecular Formula | C22H23N3S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 6-pyrimidin-5-yl-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline |
| SMILES | Cc1cc(C)c(SN2CCc3cc(-c4cncnc4)ccc3C2)c(C)c1 |
| InChI | InChI=1S/C22H23N3S/c1-15-8-16(2)22(17(3)9-15)26-25-7-6-19-10-18(4-5-20(19)13-25)21-11-23-14-24-12-21/h4-5,8-12,14H,6-7,13H2,1-3H3 |
| InChIKey | HTQBCJCBPODPPZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|