C26H27FN2OS — CID 145426086
N-[(3-fluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline-3-carboxamide (PubChem CID 145426086) has the molecular formula C26H27FN2OS and a molecular weight of 434.58 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline-3-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 145426086 |
| Molecular Formula | C26H27FN2OS |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.18 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)sulfanyl-3,4-dihydro-1H-isoquinoline-3-carboxamide |
| SMILES | Cc1cc(C)c(SN2Cc3ccccc3CC2C(=O)NCc2cccc(F)c2)c(C)c1 |
| InChI | InChI=1S/C26H27FN2OS/c1-17-11-18(2)25(19(3)12-17)31-29-16-22-9-5-4-8-21(22)14-24(29)26(30)28-15-20-7-6-10-23(27)13-20/h4-13,24H,14-16H2,1-3H3,(H,28,30) |
| InChIKey | XVYWYDLVCYJVAO-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|