About 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 145426412) has the molecular formula C20H18N2O5
and a molecular weight of 366.37 g/mol. Its IUPAC name is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 145426412 |
| Molecular Formula | C20H18N2O5 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)c1cc(-c2onc(C(N)=O)c2-c2ccc(C=O)cc2)c(O)cc1O |
| InChI | InChI=1S/C20H18N2O5/c1-10(2)13-7-14(16(25)8-15(13)24)19-17(18(20(21)26)22-27-19)12-5-3-11(9-23)4-6-12/h3-10,24-25H,1-2H3,(H2,21,26) |
| InChIKey | FMQKTDVYJDMOCT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide (CID 145426412) is 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide is CC(C)c1cc(-c2onc(C(N)=O)c2-c2ccc(C=O)cc2)c(O)cc1O.
What is the InChIKey of 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide?
The InChIKey is FMQKTDVYJDMOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N2O5/c1-10(2)13-7-14(16(25)8-15(13)24)19-17(18(20(21)26)22-27-19)12-5-3-11(9-23)4-6-12/h3-10,24-25H,1-2H3,(H2,21,26).
What are the key properties of 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide?
5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide has a molecular weight of 366.37 g/mol, XLogP of 3.45, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dihydroxy-5-propan-2-ylphenyl)-4-(4-formylphenyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 145426412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).