About ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate
ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate (PubChem CID 145426471) has the molecular formula C11H23N3O2S
and a molecular weight of 261.39 g/mol. Its IUPAC name is ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
Analyze ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The IUPAC name of ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate (CID 145426471) is ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate.
What is the SMILES notation for ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The canonical SMILES for ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate is CC.CC.CCn1cnnc1SCC(=O)OC.
What is the InChIKey of ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
The InChIKey is FHIRQSVRDSUVFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2S.2C2H6/c1-3-10-5-8-9-7(10)13-4-6(11)12-2;2*1-2/h5H,3-4H2,1-2H3;2*1-2H3.
What are the key properties of ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate?
ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate has a molecular weight of 261.39 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl 2-[(4-ethyl-1,2,4-triazol-3-yl)sulfanyl]acetate is sourced from PubChem (CID 145426471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).