About N-(3-chlorophenyl)-2,3-dihydroinden-1-imine
N-(3-chlorophenyl)-2,3-dihydroinden-1-imine (PubChem CID 145427056) has the molecular formula C15H12ClN
and a molecular weight of 241.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,3-dihydroinden-1-imine.
Molecular Properties
| Compound Name | N-(3-chlorophenyl)-2,3-dihydroinden-1-imine |
| PubChem CID | 145427056 |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(3-chlorophenyl)-2,3-dihydroinden-1-imine |
| SMILES | Clc1cccc(/N=C2\CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H12ClN/c16-12-5-3-6-13(10-12)17-15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2/b17-15+ |
| InChIKey | PQXGXLYXXPJXJD-BMRADRMJSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chlorophenyl)-2,3-dihydroinden-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chlorophenyl)-2,3-dihydroinden-1-imine?
The IUPAC name of N-(3-chlorophenyl)-2,3-dihydroinden-1-imine (CID 145427056) is N-(3-chlorophenyl)-2,3-dihydroinden-1-imine.
What is the SMILES notation for N-(3-chlorophenyl)-2,3-dihydroinden-1-imine?
The canonical SMILES for N-(3-chlorophenyl)-2,3-dihydroinden-1-imine is Clc1cccc(/N=C2\CCc3ccccc32)c1.
What is the InChIKey of N-(3-chlorophenyl)-2,3-dihydroinden-1-imine?
The InChIKey is PQXGXLYXXPJXJD-BMRADRMJSA-N. The full InChI is InChI=1S/C15H12ClN/c16-12-5-3-6-13(10-12)17-15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2/b17-15+.
What are the key properties of N-(3-chlorophenyl)-2,3-dihydroinden-1-imine?
N-(3-chlorophenyl)-2,3-dihydroinden-1-imine has a molecular weight of 241.72 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chlorophenyl)-2,3-dihydroinden-1-imine is sourced from PubChem (CID 145427056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).