C15H12ClN — CID 145427056
N-(3-chlorophenyl)-2,3-dihydroinden-1-imine (PubChem CID 145427056) has the molecular formula C15H12ClN and a molecular weight of 241.72 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,3-dihydroinden-1-imine.
| Compound Name | N-(3-chlorophenyl)-2,3-dihydroinden-1-imine |
|---|---|
| PubChem CID | 145427056 |
| Molecular Formula | C15H12ClN |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | N-(3-chlorophenyl)-2,3-dihydroinden-1-imine |
| SMILES | Clc1cccc(/N=C2\CCc3ccccc32)c1 |
| InChI | InChI=1S/C15H12ClN/c16-12-5-3-6-13(10-12)17-15-9-8-11-4-1-2-7-14(11)15/h1-7,10H,8-9H2/b17-15+ |
| InChIKey | PQXGXLYXXPJXJD-BMRADRMJSA-N |
| XLogP | 4.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|