C17H16FN — CID 145427058
N-(3-fluorophenyl)-3,3-dimethyl-2H-inden-1-imine (PubChem CID 145427058) has the molecular formula C17H16FN and a molecular weight of 253.32 g/mol. Its IUPAC name is N-(3-fluorophenyl)-3,3-dimethyl-2H-inden-1-imine.
| Compound Name | N-(3-fluorophenyl)-3,3-dimethyl-2H-inden-1-imine |
|---|---|
| PubChem CID | 145427058 |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(3-fluorophenyl)-3,3-dimethyl-2H-inden-1-imine |
| SMILES | CC1(C)C/C(=N\c2cccc(F)c2)c2ccccc21 |
| InChI | InChI=1S/C17H16FN/c1-17(2)11-16(14-8-3-4-9-15(14)17)19-13-7-5-6-12(18)10-13/h3-10H,11H2,1-2H3/b19-16+ |
| InChIKey | PXWANNWMRBYGDO-KNTRCKAVSA-N |
| XLogP | 4.63 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|