C16H29NO2 — CID 145427098
(4S,7aR)-5-ethyl-4,7a-dimethyl-4-[3-(methylamino)propyl]-3a,5,6,7-tetrahydro-3H-1-benzofuran-2-one (PubChem CID 145427098) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is (4S,7aR)-5-ethyl-4,7a-dimethyl-4-[3-(methylamino)propyl]-3a,5,6,7-tetrahydro-3H-1-benzofuran-2-one.
| Compound Name | (4S,7aR)-5-ethyl-4,7a-dimethyl-4-[3-(methylamino)propyl]-3a,5,6,7-tetrahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 145427098 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | (4S,7aR)-5-ethyl-4,7a-dimethyl-4-[3-(methylamino)propyl]-3a,5,6,7-tetrahydro-3H-1-benzofuran-2-one |
| SMILES | CCC1CC[C@@]2(C)OC(=O)CC2[C@@]1(C)CCCNC |
| InChI | InChI=1S/C16H29NO2/c1-5-12-7-9-16(3)13(11-14(18)19-16)15(12,2)8-6-10-17-4/h12-13,17H,5-11H2,1-4H3/t12?,13?,15-,16+/m0/s1 |
| InChIKey | PCXZBWKEFNTGNU-FPCDFSMTSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|