C57H33N7 — CID 145427136
2-[2-cyano-5-[3-(4-cyanophenyl)carbazol-9-yl]phenyl]-4-[3-(4-cyanophenyl)carbazol-9-yl]benzonitrile;2-methylidenebut-3-enenitrile (PubChem CID 145427136) has the molecular formula C57H33N7 and a molecular weight of 815.94 g/mol. Its IUPAC name is 2-[2-cyano-5-[3-(4-cyanophenyl)carbazol-9-yl]phenyl]-4-[3-(4-cyanophenyl)carbazol-9-yl]benzonitrile;2-methylidenebut-3-enenitrile.
| Compound Name | 2-[2-cyano-5-[3-(4-cyanophenyl)carbazol-9-yl]phenyl]-4-[3-(4-cyanophenyl)carbazol-9-yl]benzonitrile;2-methylidenebut-3-enenitrile |
|---|---|
| PubChem CID | 145427136 |
| Molecular Formula | C57H33N7 |
| Molecular Weight | 815.94 g/mol |
| Exact Mass | 815.28 |
| IUPAC Name | 2-[2-cyano-5-[3-(4-cyanophenyl)carbazol-9-yl]phenyl]-4-[3-(4-cyanophenyl)carbazol-9-yl]benzonitrile;2-methylidenebut-3-enenitrile |
| SMILES | C=CC(=C)C#N.N#Cc1ccc(-c2ccc3c(c2)c2ccccc2n3-c2ccc(C#N)c(-c3cc(-n4c5ccccc5c5cc(-c6ccc(C#N)cc6)ccc54)ccc3C#N)c2)cc1 |
| InChI | InChI=1S/C52H28N6.C5H5N/c53-29-33-9-13-35(14-10-33)37-19-23-51-47(25-37)43-5-1-3-7-49(43)57(51)41-21-17-39(31-55)45(27-41)46-28-42(22-18-40(46)32-56)58-50-8-4-2-6-44(50)48-26-38(20-24-52(48)58)36-15-11-34(30-54)12-16-36;1-3-5(2)4-6/h1-28H;3H,1-2H2 |
| InChIKey | GOOXYKABYOYNIX-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 128.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.94 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|