C26H37F2N5O2 — CID 145427267
2,2-difluoropropane;ethane;3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1-[(1-methyl-2-oxo-3-pyridinyl)amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-4-one (PubChem CID 145427267) has the molecular formula C26H37F2N5O2 and a molecular weight of 489.61 g/mol. Its IUPAC name is 2,2-difluoropropane;ethane;3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1-[(1-methyl-2-oxo-3-pyridinyl)amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-4-one.
| Compound Name | 2,2-difluoropropane;ethane;3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1-[(1-methyl-2-oxo-3-pyridinyl)amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-4-one |
|---|---|
| PubChem CID | 145427267 |
| Molecular Formula | C26H37F2N5O2 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.29 |
| IUPAC Name | 2,2-difluoropropane;ethane;3-[(3E)-6-methylhepta-1,3,5-trien-3-yl]-1-[(1-methyl-2-oxo-3-pyridinyl)amino]-5,6,7,8-tetrahydropyrido[3,4-d]pyridazin-4-one |
| SMILES | C=C/C(=C\C=C(C)C)n1nc(Nc2cccn(C)c2=O)c2c(c1=O)CNCC2.CC.CC(C)(F)F |
| InChI | InChI=1S/C21H25N5O2.C3H6F2.C2H6/c1-5-15(9-8-14(2)3)26-20(27)17-13-22-11-10-16(17)19(24-26)23-18-7-6-12-25(4)21(18)28;1-3(2,4)5;1-2/h5-9,12,22H,1,10-11,13H2,2-4H3,(H,23,24);1-2H3;1-2H3/b15-9+;; |
| InChIKey | XNKYMYSUINZPDM-CBNWXSEKSA-N |
| XLogP | 5.01 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|