C18H21N3O — CID 145427555
4-(4-methoxyphenyl)imino-5-phenylpent-2-ene-1,2-diamine (PubChem CID 145427555) has the molecular formula C18H21N3O and a molecular weight of 295.39 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)imino-5-phenylpent-2-ene-1,2-diamine.
| Compound Name | 4-(4-methoxyphenyl)imino-5-phenylpent-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 145427555 |
| Molecular Formula | C18H21N3O |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 4-(4-methoxyphenyl)imino-5-phenylpent-2-ene-1,2-diamine |
| SMILES | COc1ccc(/N=C(/C=C(N)CN)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O/c1-22-18-9-7-16(8-10-18)21-17(12-15(20)13-19)11-14-5-3-2-4-6-14/h2-10,12H,11,13,19-20H2,1H3/b15-12?,21-17+ |
| InChIKey | KJBKYKZSBNGIPP-KFYHXSGKSA-N |
| XLogP | 2.81 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|