C16H30S — CID 145427753
(2E,5E)-2-tert-butylsulfanyl-4,6,7,7-tetramethylocta-2,5-diene (PubChem CID 145427753) has the molecular formula C16H30S and a molecular weight of 254.48 g/mol. Its IUPAC name is (2E,5E)-2-tert-butylsulfanyl-4,6,7,7-tetramethylocta-2,5-diene.
| Compound Name | (2E,5E)-2-tert-butylsulfanyl-4,6,7,7-tetramethylocta-2,5-diene |
|---|---|
| PubChem CID | 145427753 |
| Molecular Formula | C16H30S |
| Molecular Weight | 254.48 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (2E,5E)-2-tert-butylsulfanyl-4,6,7,7-tetramethylocta-2,5-diene |
| SMILES | C/C(=C\C(C)/C=C(\C)C(C)(C)C)SC(C)(C)C |
| InChI | InChI=1S/C16H30S/c1-12(10-13(2)15(4,5)6)11-14(3)17-16(7,8)9/h10-12H,1-9H3/b13-10+,14-11+ |
| InChIKey | ZYMNDIWQKPQYEG-IFQMDVHZSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|