About [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium
[1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium (PubChem CID 145428076) has the molecular formula C9H14F2N3O3+
and a molecular weight of 250.22 g/mol. Its IUPAC name is [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium.
Molecular Properties
| Compound Name | [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium |
| PubChem CID | 145428076 |
| Molecular Formula | C9H14F2N3O3+ |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1cn(CC(F)F)nc1OC(C)C |
| InChI | InChI=1S/C9H14F2N3O3/c1-6(2)17-9-7(14(15)16-3)4-13(12-9)5-8(10)11/h4,6,8H,5H2,1-3H3/q+1 |
| InChIKey | AVZABNMSXXSIIS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 56.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium?
The IUPAC name of [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium (CID 145428076) is [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium.
What is the SMILES notation for [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium?
The canonical SMILES for [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium is CO[N+](=O)c1cn(CC(F)F)nc1OC(C)C.
What is the InChIKey of [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium?
The InChIKey is AVZABNMSXXSIIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2N3O3/c1-6(2)17-9-7(14(15)16-3)4-13(12-9)5-8(10)11/h4,6,8H,5H2,1-3H3/q+1.
What are the key properties of [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium?
[1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium has a molecular weight of 250.22 g/mol, XLogP of 1.91, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-difluoroethyl)-3-propan-2-yloxypyrazol-4-yl]-methoxy-oxoazanium is sourced from PubChem (CID 145428076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).