About [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone
[4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 145428146) has the molecular formula C11H17F2N5O
and a molecular weight of 273.29 g/mol. Its IUPAC name is [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| PubChem CID | 145428146 |
| Molecular Formula | C11H17F2N5O |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2nn(CC(F)F)cc2N)CC1 |
| InChI | InChI=1S/C11H17F2N5O/c1-16-2-4-17(5-3-16)11(19)10-8(14)6-18(15-10)7-9(12)13/h6,9H,2-5,7,14H2,1H3 |
| InChIKey | XBKSZFMBQFXCGQ-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone?
The IUPAC name of [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone (CID 145428146) is [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone.
What is the SMILES notation for [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone?
The canonical SMILES for [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone is CN1CCN(C(=O)c2nn(CC(F)F)cc2N)CC1.
What is the InChIKey of [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone?
The InChIKey is XBKSZFMBQFXCGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17F2N5O/c1-16-2-4-17(5-3-16)11(19)10-8(14)6-18(15-10)7-9(12)13/h6,9H,2-5,7,14H2,1H3.
What are the key properties of [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone?
[4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone has a molecular weight of 273.29 g/mol, XLogP of 0.12, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-amino-1-(2,2-difluoroethyl)pyrazol-3-yl]-(4-methylpiperazin-1-yl)methanone is sourced from PubChem (CID 145428146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).