C7H10N3O3+ — CID 145428396
6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl-methoxy-oxoazanium (PubChem CID 145428396) has the molecular formula C7H10N3O3+ and a molecular weight of 184.17 g/mol. Its IUPAC name is 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl-methoxy-oxoazanium.
| Compound Name | 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl-methoxy-oxoazanium |
|---|---|
| PubChem CID | 145428396 |
| Molecular Formula | C7H10N3O3+ |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-3-yl-methoxy-oxoazanium |
| SMILES | CO[N+](=O)c1cnn2c1COCC2 |
| InChI | InChI=1S/C7H10N3O3/c1-12-10(11)6-4-8-9-2-3-13-5-7(6)9/h4H,2-3,5H2,1H3/q+1 |
| InChIKey | ILTVWBYZBJPSDZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 56.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|