C17H19ClFN5O2S — CID 145428476
4-[(4-chloro-2-fluorophenyl)methylidene]-N-[(Z)-(1,3-diamino-3-oxopropylidene)carbamothioyl]piperidine-1-carboxamide (PubChem CID 145428476) has the molecular formula C17H19ClFN5O2S and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-[(4-chloro-2-fluorophenyl)methylidene]-N-[(Z)-(1,3-diamino-3-oxopropylidene)carbamothioyl]piperidine-1-carboxamide.
| Compound Name | 4-[(4-chloro-2-fluorophenyl)methylidene]-N-[(Z)-(1,3-diamino-3-oxopropylidene)carbamothioyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 145428476 |
| Molecular Formula | C17H19ClFN5O2S |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 4-[(4-chloro-2-fluorophenyl)methylidene]-N-[(Z)-(1,3-diamino-3-oxopropylidene)carbamothioyl]piperidine-1-carboxamide |
| SMILES | NC(=O)C/C(N)=N/C(=S)NC(=O)N1CCC(=Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C17H19ClFN5O2S/c18-12-2-1-11(13(19)8-12)7-10-3-5-24(6-4-10)17(26)23-16(27)22-14(20)9-15(21)25/h1-2,7-8H,3-6,9H2,(H2,21,25)(H3,20,22,23,26,27) |
| InChIKey | QOIGYDKWVCQJLM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|