C32H30N6 — CID 145428544
[2-[(E)-but-2-en-2-yl]-2,3-dihydro-1H-perimidin-6-yl]-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]naphthalen-1-yl]diazene (PubChem CID 145428544) has the molecular formula C32H30N6 and a molecular weight of 498.63 g/mol. Its IUPAC name is [2-[(E)-but-2-en-2-yl]-2,3-dihydro-1H-perimidin-6-yl]-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]naphthalen-1-yl]diazene.
| Compound Name | [2-[(E)-but-2-en-2-yl]-2,3-dihydro-1H-perimidin-6-yl]-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]naphthalen-1-yl]diazene |
|---|---|
| PubChem CID | 145428544 |
| Molecular Formula | C32H30N6 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [2-[(E)-but-2-en-2-yl]-2,3-dihydro-1H-perimidin-6-yl]-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]diazenyl]naphthalen-1-yl]diazene |
| SMILES | C=CC(=C\C=C/C)/N=N/c1ccc(/N=N/c2ccc3c4c(cccc24)NC(/C(C)=C/C)N3)c2ccccc12 |
| InChI | InChI=1S/C32H30N6/c1-5-8-12-22(7-3)35-36-26-17-18-27(24-14-10-9-13-23(24)26)37-38-28-19-20-30-31-25(28)15-11-16-29(31)33-32(34-30)21(4)6-2/h5-20,32-34H,3H2,1-2,4H3/b8-5-,21-6+,22-12+,36-35+,38-37+ |
| InChIKey | LPCRVEMHTIXIEK-OVOWEYHRSA-N |
| XLogP | 10.27 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|