C26H40 — CID 145429005
ethane;(5E)-6-ethenyl-4-ethyl-4,6-dimethyl-1-[(3E,5Z)-nona-1,3,5,8-tetraen-4-yl]-5-propylidenecyclohexene (PubChem CID 145429005) has the molecular formula C26H40 and a molecular weight of 352.61 g/mol. Its IUPAC name is ethane;(5E)-6-ethenyl-4-ethyl-4,6-dimethyl-1-[(3E,5Z)-nona-1,3,5,8-tetraen-4-yl]-5-propylidenecyclohexene.
| Compound Name | ethane;(5E)-6-ethenyl-4-ethyl-4,6-dimethyl-1-[(3E,5Z)-nona-1,3,5,8-tetraen-4-yl]-5-propylidenecyclohexene |
|---|---|
| PubChem CID | 145429005 |
| Molecular Formula | C26H40 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.31 |
| IUPAC Name | ethane;(5E)-6-ethenyl-4-ethyl-4,6-dimethyl-1-[(3E,5Z)-nona-1,3,5,8-tetraen-4-yl]-5-propylidenecyclohexene |
| SMILES | C=C/C=C(\C=C/CC=C)C1=CCC(C)(CC)/C(=C\CC)C1(C)C=C.CC |
| InChI | InChI=1S/C24H34.C2H6/c1-8-13-14-17-20(15-9-2)21-18-19-23(6,11-4)22(16-10-3)24(21,7)12-5;1-2/h8-9,12,14-18H,1-2,5,10-11,13,19H2,3-4,6-7H3;1-2H3/b17-14-,20-15+,22-16+; |
| InChIKey | PJQLBKSVZNDBDE-BPLIQLEKSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|