C43H71N — CID 145429024
(5E)-1-(4-tert-butylphenyl)-4-ethyl-4,6,6-trimethyl-5-propylidenecyclohexene;ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-1-pent-1-en-2-ylpiperidine (PubChem CID 145429024) has the molecular formula C43H71N and a molecular weight of 602.05 g/mol. Its IUPAC name is (5E)-1-(4-tert-butylphenyl)-4-ethyl-4,6,6-trimethyl-5-propylidenecyclohexene;ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-1-pent-1-en-2-ylpiperidine.
| Compound Name | (5E)-1-(4-tert-butylphenyl)-4-ethyl-4,6,6-trimethyl-5-propylidenecyclohexene;ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-1-pent-1-en-2-ylpiperidine |
|---|---|
| PubChem CID | 145429024 |
| Molecular Formula | C43H71N |
| Molecular Weight | 602.05 g/mol |
| Exact Mass | 601.56 |
| IUPAC Name | (5E)-1-(4-tert-butylphenyl)-4-ethyl-4,6,6-trimethyl-5-propylidenecyclohexene;ethane;4-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-methyl-1-pent-1-en-2-ylpiperidine |
| SMILES | C=C(CCC)N1CCC(C)(C(/C=C\C)=C/C)CC1.CC.CC/C=C1\C(C)(CC)CC=C(c2ccc(C(C)(C)C)cc2)C1(C)C |
| InChI | InChI=1S/C24H36.C17H29N.C2H6/c1-9-11-21-23(6,7)20(16-17-24(21,8)10-2)18-12-14-19(15-13-18)22(3,4)5;1-6-9-15(4)18-13-11-17(5,12-14-18)16(8-3)10-7-2;1-2/h11-16H,9-10,17H2,1-8H3;7-8,10H,4,6,9,11-14H2,1-3,5H3;1-2H3/b21-11-;10-7-,16-8+; |
| InChIKey | FYFKPLMTKKDSCV-AUHNWABASA-N |
| XLogP | 13.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.05 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|