C24H32N2O — CID 145429104
(5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-2-yl)-(4-phenylpiperidin-4-yl)methanone (PubChem CID 145429104) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-2-yl)-(4-phenylpiperidin-4-yl)methanone.
| Compound Name | (5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-2-yl)-(4-phenylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 145429104 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (5,5,8a-trimethyl-3,8-dihydro-1H-isoquinolin-2-yl)-(4-phenylpiperidin-4-yl)methanone |
| SMILES | CC1(C)C=CCC2(C)CN(C(=O)C3(c4ccccc4)CCNCC3)CC=C12 |
| InChI | InChI=1S/C24H32N2O/c1-22(2)11-7-12-23(3)18-26(17-10-20(22)23)21(27)24(13-15-25-16-14-24)19-8-5-4-6-9-19/h4-11,25H,12-18H2,1-3H3 |
| InChIKey | CDMGTAGRQZFYQF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|