C33H43IN2 — CID 145429241
5-[[(8aS)-5,5,8a-trimethyl-6-(4-prop-1-en-2-ylphenyl)-3,8-dihydro-1H-isoquinolin-2-yl]-(methyl-λ3-iodanylidene)methyl]-2-methyl-N-propan-2-ylaniline (PubChem CID 145429241) has the molecular formula C33H43IN2 and a molecular weight of 594.63 g/mol. Its IUPAC name is 5-[[(8aS)-5,5,8a-trimethyl-6-(4-prop-1-en-2-ylphenyl)-3,8-dihydro-1H-isoquinolin-2-yl]-(methyl-λ3-iodanylidene)methyl]-2-methyl-N-propan-2-ylaniline.
| Compound Name | 5-[[(8aS)-5,5,8a-trimethyl-6-(4-prop-1-en-2-ylphenyl)-3,8-dihydro-1H-isoquinolin-2-yl]-(methyl-λ3-iodanylidene)methyl]-2-methyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 145429241 |
| Molecular Formula | C33H43IN2 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.25 |
| IUPAC Name | 5-[[(8aS)-5,5,8a-trimethyl-6-(4-prop-1-en-2-ylphenyl)-3,8-dihydro-1H-isoquinolin-2-yl]-(methyl-λ3-iodanylidene)methyl]-2-methyl-N-propan-2-ylaniline |
| SMILES | C=C(C)c1ccc(C2=CC[C@]3(C)CN(/C(=I/C)c4ccc(C)c(NC(C)C)c4)CC=C3C2(C)C)cc1 |
| InChI | InChI=1S/C33H43IN2/c1-22(2)25-12-14-26(15-13-25)28-16-18-33(8)21-36(19-17-30(33)32(28,6)7)31(34-9)27-11-10-24(5)29(20-27)35-23(3)4/h10-17,20,23,35H,1,18-19,21H2,2-9H3/t33-/m1/s1 |
| InChIKey | AWIHHQIYSJMXIJ-MGBGTMOVSA-N |
| XLogP | 8.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|