About ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene
ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene (PubChem CID 145429260) has the molecular formula C22H33N
and a molecular weight of 311.51 g/mol. Its IUPAC name is ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene.
Molecular Properties
| Compound Name | ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene |
| PubChem CID | 145429260 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene |
| SMILES | C/C=C1/C(C)(C)C(c2ccc(CC)cc2)=CCC12CN2C.CC |
| InChI | InChI=1S/C20H27N.C2H6/c1-6-15-8-10-16(11-9-15)17-12-13-20(14-21(20)5)18(7-2)19(17,3)4;1-2/h7-12H,6,13-14H2,1-5H3;1-2H3/b18-7-; |
| InChIKey | SSNHHHNDDCPQFS-AMWHJWHASA-N |
| XLogP | 5.72 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene?
The IUPAC name of ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene (CID 145429260) is ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene.
What is the SMILES notation for ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene?
The canonical SMILES for ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene is C/C=C1/C(C)(C)C(c2ccc(CC)cc2)=CCC12CN2C.CC.
What is the InChIKey of ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene?
The InChIKey is SSNHHHNDDCPQFS-AMWHJWHASA-N. The full InChI is InChI=1S/C20H27N.C2H6/c1-6-15-8-10-16(11-9-15)17-12-13-20(14-21(20)5)18(7-2)19(17,3)4;1-2/h7-12H,6,13-14H2,1-5H3;1-2H3/b18-7-;.
What are the key properties of ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene?
ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene has a molecular weight of 311.51 g/mol, XLogP of 5.72, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4Z)-4-ethylidene-6-(4-ethylphenyl)-1,5,5-trimethyl-1-azaspiro[2.5]oct-6-ene is sourced from PubChem (CID 145429260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).