C23H38O2 — CID 145429366
(3R,5R,6S,10R,17R)-10-methyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-3,6-diol (PubChem CID 145429366) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is (3R,5R,6S,10R,17R)-10-methyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-3,6-diol.
| Compound Name | (3R,5R,6S,10R,17R)-10-methyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-3,6-diol |
|---|---|
| PubChem CID | 145429366 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | (3R,5R,6S,10R,17R)-10-methyl-17-[(2R)-pent-4-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,13,14,15,16,17-hexadecahydrocyclopenta[a]phenanthrene-3,6-diol |
| SMILES | C=CC[C@@H](C)[C@H]1CCC2C3C[C@H](O)[C@@H]4C[C@H](O)CC[C@]4(C)C3CCC21 |
| InChI | InChI=1S/C23H38O2/c1-4-5-14(2)16-6-7-18-17(16)8-9-20-19(18)13-22(25)21-12-15(24)10-11-23(20,21)3/h4,14-22,24-25H,1,5-13H2,2-3H3/t14-,15-,16-,17?,18?,19?,20?,21+,22+,23-/m1/s1 |
| InChIKey | YJOTZSLZYKHPHO-CADCESQSSA-N |
| XLogP | 4.80 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|