C20H29BrO4 — CID 14542947
1-bromo-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-bis(methoxymethoxy)benzene (PubChem CID 14542947) has the molecular formula C20H29BrO4 and a molecular weight of 413.35 g/mol. Its IUPAC name is 1-bromo-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-bis(methoxymethoxy)benzene.
| Compound Name | 1-bromo-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-bis(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 14542947 |
| Molecular Formula | C20H29BrO4 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 1-bromo-4-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-bis(methoxymethoxy)benzene |
| SMILES | COCOc1cc(C/C=C(\C)CCC=C(C)C)c(OCOC)cc1Br |
| InChI | InChI=1S/C20H29BrO4/c1-15(2)7-6-8-16(3)9-10-17-11-20(25-14-23-5)18(21)12-19(17)24-13-22-4/h7,9,11-12H,6,8,10,13-14H2,1-5H3/b16-9+ |
| InChIKey | BUWGRXNGHYAFEF-CXUHLZMHSA-N |
| XLogP | 5.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|