C29H38 — CID 145429599
4,4,7,7,17,17,20,20-octamethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),9,14,16(21)-hexaene (PubChem CID 145429599) has the molecular formula C29H38 and a molecular weight of 386.62 g/mol. Its IUPAC name is 4,4,7,7,17,17,20,20-octamethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),9,14,16(21)-hexaene.
| Compound Name | 4,4,7,7,17,17,20,20-octamethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),9,14,16(21)-hexaene |
|---|---|
| PubChem CID | 145429599 |
| Molecular Formula | C29H38 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | 4,4,7,7,17,17,20,20-octamethylpentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3(8),9,14,16(21)-hexaene |
| SMILES | CC1(C)CCC(C)(C)c2c1ccc1c2-c2c(ccc3c2C(C)(C)CCC3(C)C)C1 |
| InChI | InChI=1S/C29H38/c1-26(2)13-15-28(5,6)24-20(26)11-9-18-17-19-10-12-21-25(23(19)22(18)24)29(7,8)16-14-27(21,3)4/h9-12H,13-17H2,1-8H3 |
| InChIKey | GHVFUXCEUADBNG-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |