About 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine
3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine (PubChem CID 145430038) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine.
Molecular Properties
| Compound Name | 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine |
| PubChem CID | 145430038 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine |
| SMILES | C=C(C)/C=C\C(=C)C1CNC1 |
| InChI | InChI=1S/C10H15N/c1-8(2)4-5-9(3)10-6-11-7-10/h4-5,10-11H,1,3,6-7H2,2H3/b5-4- |
| InChIKey | GZVVJNYCZWIESE-PLNGDYQASA-N |
| XLogP | 1.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine?
The IUPAC name of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine (CID 145430038) is 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine.
What is the SMILES notation for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine?
The canonical SMILES for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine is C=C(C)/C=C\C(=C)C1CNC1.
What is the InChIKey of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine?
The InChIKey is GZVVJNYCZWIESE-PLNGDYQASA-N. The full InChI is InChI=1S/C10H15N/c1-8(2)4-5-9(3)10-6-11-7-10/h4-5,10-11H,1,3,6-7H2,2H3/b5-4-.
What are the key properties of 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine?
3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine has a molecular weight of 149.24 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]azetidine is sourced from PubChem (CID 145430038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).