About (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane
(5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane (PubChem CID 145430746) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane.
Molecular Properties
| Compound Name | (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane |
| PubChem CID | 145430746 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane |
| SMILES | C=C/C=C1/CN(CC=C)COC1=C |
| InChI | InChI=1S/C11H15NO/c1-4-6-11-8-12(7-5-2)9-13-10(11)3/h4-6H,1-3,7-9H2/b11-6- |
| InChIKey | QJSYCURSEZHIGP-WDZFZDKYSA-N |
| XLogP | 2.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane?
The IUPAC name of (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane (CID 145430746) is (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane.
What is the SMILES notation for (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane?
The canonical SMILES for (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane is C=C/C=C1/CN(CC=C)COC1=C.
What is the InChIKey of (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane?
The InChIKey is QJSYCURSEZHIGP-WDZFZDKYSA-N. The full InChI is InChI=1S/C11H15NO/c1-4-6-11-8-12(7-5-2)9-13-10(11)3/h4-6H,1-3,7-9H2/b11-6-.
What are the key properties of (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane?
(5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane has a molecular weight of 177.25 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-6-methylidene-3-prop-2-enyl-5-prop-2-enylidene-1,3-oxazinane is sourced from PubChem (CID 145430746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).