C15H28N2OS — CID 145431106
2-methylpropane-2-thiol;2-methyl-6-propan-2-yloxy-4,5,6,7-tetrahydroindazole (PubChem CID 145431106) has the molecular formula C15H28N2OS and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-methylpropane-2-thiol;2-methyl-6-propan-2-yloxy-4,5,6,7-tetrahydroindazole.
| Compound Name | 2-methylpropane-2-thiol;2-methyl-6-propan-2-yloxy-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 145431106 |
| Molecular Formula | C15H28N2OS |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-methylpropane-2-thiol;2-methyl-6-propan-2-yloxy-4,5,6,7-tetrahydroindazole |
| SMILES | CC(C)(C)S.CC(C)OC1CCc2cn(C)nc2C1 |
| InChI | InChI=1S/C11H18N2O.C4H10S/c1-8(2)14-10-5-4-9-7-13(3)12-11(9)6-10;1-4(2,3)5/h7-8,10H,4-6H2,1-3H3;5H,1-3H3 |
| InChIKey | UURNURGTUIQAJZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|