C10H18FN — CID 145431755
2-ethyl-3-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole (PubChem CID 145431755) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 2-ethyl-3-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole.
| Compound Name | 2-ethyl-3-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
|---|---|
| PubChem CID | 145431755 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-ethyl-3-fluoro-2,3,3a,4,5,6,7,7a-octahydro-1H-indole |
| SMILES | CCC1NC2CCCCC2C1F |
| InChI | InChI=1S/C10H18FN/c1-2-8-10(11)7-5-3-4-6-9(7)12-8/h7-10,12H,2-6H2,1H3 |
| InChIKey | HCUSGXIGKZTGMZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |