C35H52F2N2 — CID 145432177
(5Z,7E,8E)-7-ethylidene-11,11-difluoro-5-methyl-9-[2-methyl-5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]phenyl]-8-propylundeca-5,8-dien-4-imine (PubChem CID 145432177) has the molecular formula C35H52F2N2 and a molecular weight of 538.81 g/mol. Its IUPAC name is (5Z,7E,8E)-7-ethylidene-11,11-difluoro-5-methyl-9-[2-methyl-5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]phenyl]-8-propylundeca-5,8-dien-4-imine.
| Compound Name | (5Z,7E,8E)-7-ethylidene-11,11-difluoro-5-methyl-9-[2-methyl-5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]phenyl]-8-propylundeca-5,8-dien-4-imine |
|---|---|
| PubChem CID | 145432177 |
| Molecular Formula | C35H52F2N2 |
| Molecular Weight | 538.81 g/mol |
| Exact Mass | 538.41 |
| IUPAC Name | (5Z,7E,8E)-7-ethylidene-11,11-difluoro-5-methyl-9-[2-methyl-5-[1-(4-methylpent-1-en-2-yl)piperidin-4-yl]phenyl]-8-propylundeca-5,8-dien-4-imine |
| SMILES | [H]/N=C(CCC)/C(C)=C\C(=C/C)\C(CCC)=C(/CC(F)F)c1cc(C2CCN(C(=C)CC(C)C)CC2)ccc1C |
| InChI | InChI=1S/C35H52F2N2/c1-9-12-31(28(11-3)21-26(7)34(38)13-10-2)33(23-35(36)37)32-22-30(15-14-25(32)6)29-16-18-39(19-17-29)27(8)20-24(4)5/h11,14-15,21-22,24,29,35,38H,8-10,12-13,16-20,23H2,1-7H3/b26-21-,28-11+,33-31+,38-34+ |
| InChIKey | JCRBHRRXFSWNJY-XXGMJPFCSA-N |
| XLogP | 10.66 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.81 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|