About 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one
6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one (PubChem CID 14543235) has the molecular formula C15H24O4
and a molecular weight of 268.35 g/mol. Its IUPAC name is 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one.
Molecular Properties
| Compound Name | 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one |
| PubChem CID | 14543235 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one |
| SMILES | CC(C)=CC(=O)CC(C)C1CC(O)C(C)(O)C2OC12 |
| InChI | InChI=1S/C15H24O4/c1-8(2)5-10(16)6-9(3)11-7-12(17)15(4,18)14-13(11)19-14/h5,9,11-14,17-18H,6-7H2,1-4H3 |
| InChIKey | YFDIAFVTFRYMNI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one?
The IUPAC name of 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one (CID 14543235) is 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one.
What is the SMILES notation for 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one?
The canonical SMILES for 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one is CC(C)=CC(=O)CC(C)C1CC(O)C(C)(O)C2OC12.
What is the InChIKey of 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one?
The InChIKey is YFDIAFVTFRYMNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-8(2)5-10(16)6-9(3)11-7-12(17)15(4,18)14-13(11)19-14/h5,9,11-14,17-18H,6-7H2,1-4H3.
What are the key properties of 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one?
6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one has a molecular weight of 268.35 g/mol, XLogP of 1.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)-2-methylhept-2-en-4-one is sourced from PubChem (CID 14543235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).