C15H24O4 — CID 14543236
(6S)-6-[(1S,2R,4S,5R,6S)-4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]-2-methylhept-2-en-4-one (PubChem CID 14543236) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (6S)-6-[(1S,2R,4S,5R,6S)-4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]-2-methylhept-2-en-4-one.
| Compound Name | (6S)-6-[(1S,2R,4S,5R,6S)-4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]-2-methylhept-2-en-4-one |
|---|---|
| PubChem CID | 14543236 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (6S)-6-[(1S,2R,4S,5R,6S)-4,5-dihydroxy-5-methyl-7-oxabicyclo[4.1.0]heptan-2-yl]-2-methylhept-2-en-4-one |
| SMILES | CC(C)=CC(=O)C[C@H](C)[C@H]1C[C@H](O)[C@@](C)(O)[C@H]2O[C@@H]12 |
| InChI | InChI=1S/C15H24O4/c1-8(2)5-10(16)6-9(3)11-7-12(17)15(4,18)14-13(11)19-14/h5,9,11-14,17-18H,6-7H2,1-4H3/t9-,11+,12-,13-,14-,15+/m0/s1 |
| InChIKey | YFDIAFVTFRYMNI-WUXGHAJSSA-N |
| XLogP | 1.45 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|