C33H49N3O — CID 145432400
N-[(4Z,6E,7E)-6-ethylidene-9-methyl-8-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]-7-propyldeca-4,7-dien-3-ylidene]ethanimidamide (PubChem CID 145432400) has the molecular formula C33H49N3O and a molecular weight of 503.78 g/mol. Its IUPAC name is N-[(4Z,6E,7E)-6-ethylidene-9-methyl-8-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]-7-propyldeca-4,7-dien-3-ylidene]ethanimidamide.
| Compound Name | N-[(4Z,6E,7E)-6-ethylidene-9-methyl-8-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]-7-propyldeca-4,7-dien-3-ylidene]ethanimidamide |
|---|---|
| PubChem CID | 145432400 |
| Molecular Formula | C33H49N3O |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 503.39 |
| IUPAC Name | N-[(4Z,6E,7E)-6-ethylidene-9-methyl-8-[2-methyl-5-[1-(oxetan-3-yl)piperidin-4-yl]phenyl]-7-propyldeca-4,7-dien-3-ylidene]ethanimidamide |
| SMILES | [H]/N=C(C)/N=C(/C=C\C(=C/C)\C(CCC)=C(\c1cc(C2CCN(C3COC3)CC2)ccc1C)C(C)C)CC |
| InChI | InChI=1S/C33H49N3O/c1-8-11-31(26(9-2)14-15-29(10-3)35-25(7)34)33(23(4)5)32-20-28(13-12-24(32)6)27-16-18-36(19-17-27)30-21-37-22-30/h9,12-15,20,23,27,30,34H,8,10-11,16-19,21-22H2,1-7H3/b15-14-,26-9+,33-31+,34-25+,35-29+ |
| InChIKey | MJMNIUXZASNYGJ-JTHZTBJBSA-N |
| XLogP | 8.13 |
| TPSA | 48.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|