C28H30N2O5S — CID 145432868
2-[(5Z)-5-[5-(2-cyclohexylethynyl)-1-(cyclohexylmethyl)-2-oxoindol-3-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 145432868) has the molecular formula C28H30N2O5S and a molecular weight of 506.62 g/mol. Its IUPAC name is 2-[(5Z)-5-[5-(2-cyclohexylethynyl)-1-(cyclohexylmethyl)-2-oxoindol-3-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[5-(2-cyclohexylethynyl)-1-(cyclohexylmethyl)-2-oxoindol-3-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 145432868 |
| Molecular Formula | C28H30N2O5S |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 2-[(5Z)-5-[5-(2-cyclohexylethynyl)-1-(cyclohexylmethyl)-2-oxoindol-3-ylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C2\C(=O)N(CC3CCCCC3)c3ccc(C#CC4CCCCC4)cc32)C1=O |
| InChI | InChI=1S/C28H30N2O5S/c31-23(32)17-30-27(34)25(36-28(30)35)24-21-15-19(12-11-18-7-3-1-4-8-18)13-14-22(21)29(26(24)33)16-20-9-5-2-6-10-20/h13-15,18,20H,1-10,16-17H2,(H,31,32)/b25-24- |
| InChIKey | RPDLJWBIAOHCPQ-IZHYLOQSSA-N |
| XLogP | 5.04 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|