C23H20N2O5S — CID 145432963
2-[(5Z)-2,4-dioxo-5-[2-oxo-1-(4-phenylbutyl)indol-3-ylidene]-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 145432963) has the molecular formula C23H20N2O5S and a molecular weight of 436.49 g/mol. Its IUPAC name is 2-[(5Z)-2,4-dioxo-5-[2-oxo-1-(4-phenylbutyl)indol-3-ylidene]-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-2,4-dioxo-5-[2-oxo-1-(4-phenylbutyl)indol-3-ylidene]-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 145432963 |
| Molecular Formula | C23H20N2O5S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 2-[(5Z)-2,4-dioxo-5-[2-oxo-1-(4-phenylbutyl)indol-3-ylidene]-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)S/C(=C2\C(=O)N(CCCCc3ccccc3)c3ccccc32)C1=O |
| InChI | InChI=1S/C23H20N2O5S/c26-18(27)14-25-22(29)20(31-23(25)30)19-16-11-4-5-12-17(16)24(21(19)28)13-7-6-10-15-8-2-1-3-9-15/h1-5,8-9,11-12H,6-7,10,13-14H2,(H,26,27)/b20-19- |
| InChIKey | MKSQKSOAJDBSFX-VXPUYCOJSA-N |
| XLogP | 3.55 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|