C21H29BO7 — CID 145433009
5-methoxy-2,2-dimethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxolan-3-yl]-1,3-benzodioxin-4-one (PubChem CID 145433009) has the molecular formula C21H29BO7 and a molecular weight of 404.27 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxolan-3-yl]-1,3-benzodioxin-4-one.
| Compound Name | 5-methoxy-2,2-dimethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxolan-3-yl]-1,3-benzodioxin-4-one |
|---|---|
| PubChem CID | 145433009 |
| Molecular Formula | C21H29BO7 |
| Molecular Weight | 404.27 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxolan-3-yl]-1,3-benzodioxin-4-one |
| SMILES | COc1ccc(C2COCC2B2OC(C)(C)C(C)(C)O2)c2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C21H29BO7/c1-19(2)20(3,4)29-22(28-19)14-11-25-10-13(14)12-8-9-15(24-7)16-17(12)26-21(5,6)27-18(16)23/h8-9,13-14H,10-11H2,1-7H3 |
| InChIKey | UHKINMNMLVTHDM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.27 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|