C16H15F3O8S — CID 145433018
[4-(5-methoxy-2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-2,5-dihydrofuran-3-yl] trifluoromethanesulfonate (PubChem CID 145433018) has the molecular formula C16H15F3O8S and a molecular weight of 424.35 g/mol. Its IUPAC name is [4-(5-methoxy-2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-2,5-dihydrofuran-3-yl] trifluoromethanesulfonate.
| Compound Name | [4-(5-methoxy-2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-2,5-dihydrofuran-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145433018 |
| Molecular Formula | C16H15F3O8S |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | [4-(5-methoxy-2,2-dimethyl-4-oxo-1,3-benzodioxin-8-yl)-2,5-dihydrofuran-3-yl] trifluoromethanesulfonate |
| SMILES | COc1ccc(C2=C(OS(=O)(=O)C(F)(F)F)COC2)c2c1C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C16H15F3O8S/c1-15(2)25-13-8(4-5-10(23-3)12(13)14(20)26-15)9-6-24-7-11(9)27-28(21,22)16(17,18)19/h4-5H,6-7H2,1-3H3 |
| InChIKey | XXHIMJSNPVPWPL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|